RefMet Compound Details

Created with Raphaƫl 2.1.0OHOOHO
RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0134982
RefMet nameSuccinic acid
Systematic nameButanedioic acid
SynonymsPubChem Synonyms
Exact mass118.026610 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC4H6O4View other entries in RefMet with this formula
Molecular descriptors
Molfile1966 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8)
InChIKeyKDYFGRWQOYBRFD-UHFFFAOYSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESC(CC(=O)O)C(=O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassOrganic acids
Main ClassTCA acids
Sub ClassTCA acids
Distribution of Succinic acid in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting Succinic acid
External Links
Pubchem CID1110
LIPID MAPSLMFA01170043
ChEBI ID15741
KEGG IDC00042
HMDB IDHMDB0000254
Chemspider ID1078
MetaCyc IDSUC
EPA CompToxDTXCID303602
Spectral data for Succinic acid standards
BMRB ID(NMR)View NMR spectra
NP-MRD ID(NMR)View NMR spectra
MassBank(EU)View MS spectra
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Succinic acid

Rxn IDKEGG ReactionEnzyme
R00402 Succinate + NAD+ <=> Fumarate + NADH + H+succinate:NAD+ oxidoreductase
R00405 ATP + Succinate + CoA <=> ADP + Orthophosphate + Succinyl-CoASuccinate:CoA ligase (ADP-forming)
R00406 Succinyl-CoA + (S)-Malate <=> Succinate + L-Malyl-CoAsuccinyl-CoA:(S)-malate CoA-transferase
R00432 GTP + Succinate + CoA <=> GDP + Orthophosphate + Succinyl-CoASuccinate:CoA ligase (GDP-forming)
R00713 Succinate semialdehyde + NAD+ + H2O <=> Succinate + NADH + H+succinate-semialdehyde:NAD+ oxidoreductase
R00714 Succinate semialdehyde + NADP+ + H2O <=> Succinate + NADPH + H+succinate-semialdehyde:NADP+ oxidoreductase
R00727 ITP + Succinate + CoA <=> IDP + Orthophosphate + Succinyl-CoASuccinate:CoA ligase (IDP-forming)
R02164 Quinone + Succinate <=> Hydroquinone + Fumaratesuccinate:quinone oxidoreductase
R10343 Succinyl-CoA + Acetate <=> Acetyl-CoA + Succinatesuccinyl-CoA:acetate CoA-transferase
R10660 Fumarate + Coenzyme M + Coenzyme B <=> Succinate + Coenzyme M 7-mercaptoheptanoylthreonine-phosphate heterodisulfidefumarate CoM:CoB oxidoreductase (succinate forming)

Table of KEGG human pathways containing Succinic acid

Pathway IDHuman Pathway# of reactions
hsa01100 Metabolic pathways 5
hsa01200 Carbon metabolism 5
hsa00020 Citrate cycle (TCA cycle) 3
hsa00640 Propanoate metabolism 2
hsa00250 Alanine, aspartate and glutamate metabolism 1
hsa00650 Butanoate metabolism 1
  logo