RefMet Compound Details
MW structure | 62844 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | TMP | |
Systematic name | Thymidine-5'- monophosphate | |
SMILES | Cc1cn([C@H]2[C@@H]([C@@H]([C@@H](COP(=O)(O)O)O2)O)O)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 338.051521 (neutral) |
Table of KEGG reactions in human pathways involving TMP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00615 | Thiamin diphosphate + H2O <=> Thiamin monophosphate + Orthophosphate | Thiamin diphosphate phosphohydrolase |
R00617 | ATP + Thiamin monophosphate <=> ADP + Thiamin diphosphate | ATP:thiamin-phosphate phosphotransferase |
R02134 | ATP + Thiamine <=> ADP + Thiamin monophosphate | ATP:thiamine phosphotransferase |
R02135 | Thiamin monophosphate + H2O <=> Thiamine + Orthophosphate | thiamin monophosphate phosphohydrolase |
Table of KEGG human pathways containing TMP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00730 | Thiamine metabolism | 2 |
hsa01100 | Metabolic pathways | 2 |