RefMet Compound Details
RefMet ID | RM0128369 | |
---|---|---|
MW structure | 36989 (View MW Metabolite Database details) | |
RefMet name | Taurochenodeoxycholic acid | |
Systematic name | N-(3alpha,7alpha-dihydroxy-5beta-cholan-24-oyl)-taurine | |
SMILES | C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]1(C)CC[C@H](C[C@H]1C[C@H]3O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 24:1;O4;T | View other entries in RefMet with this sum composition |
Exact mass | 499.296761 (neutral) |
Table of KEGG reactions in human pathways involving Taurochenodeoxycholic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08745 | Chenodeoxycholoyl-CoA + Taurine <=> Taurochenodeoxycholate + CoA | 3alpha,7alpha-dihydroxy-5beta-cholanoyl-CoA:taurine N-choloyltransferase |
Table of KEGG human pathways containing Taurochenodeoxycholic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00120 | Primary bile acid biosynthesis | 1 |