RefMet Compound Details
MW structure | 40909 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Tetrahydroaldosterone-3-glucuronide | |
Systematic name | (2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-{[(2S,14S,16S)-18-hydroxy-2-(2-hydroxyacetyl)-14-methyl-17-oxapentacyclo[14.2.1.0^{1,5}.0^{6,15}.0^{9,14}]nonadecan-11-yl]oxy}oxane-2-carboxylic acid | |
SMILES | C[C@]12CC[C@H](C[C@H]1CC[C@H]1[C@@H]3CC[C@H](C(=O)CO)[C@]43C[C@@H]([C@H]21)OC4O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:2;O5;GlcA | View other entries in RefMet with this sum composition |
Exact mass | 540.257065 (neutral) |
Table of KEGG reactions in human pathways involving Tetrahydroaldosterone-3-glucuronide
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01478 | H2O + beta-D-Glucuronoside <=> D-Glucuronate + Alcohol | beta-D-glucuronoside glucuronosohydrolase |
R01383 | UDP-glucuronate + ROH <=> UDP + beta-D-Glucuronoside | UDPglucuronate beta-D-glucuronosyltransferase (acceptor-unspecific) |
Table of KEGG human pathways containing Tetrahydroaldosterone-3-glucuronide
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00040 | Pentose and glucuronate interconversions | 2 |