RefMet Compound Details
MW structure | 35401 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Tetrahydrocorticosterone | |
Systematic name | 3alpha,11beta,21-5alpha-trihydroxy-pregnane-20-one | |
SMILES | C[C@]12CC[C@H](C[C@H]1CC[C@H]1[C@@H]3CC[C@H](C(=O)CO)[C@@]3(C)C[C@@H]([C@H]21)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:1;O4 | View other entries in RefMet with this sum composition |
Exact mass | 350.245710 (neutral) |
Table of KEGG reactions in human pathways involving Tetrahydrocorticosterone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04837 | Tetrahydrocorticosterone + NAD+ <=> 11beta,21-Dihydroxy-5beta-pregnane-3,20-dione + NADH + H+ | Tetrahydrocorticosterone:NAD+ oxidoreductase (B-specific) |
R04838 | Tetrahydrocorticosterone + NADP+ <=> 11beta,21-Dihydroxy-5beta-pregnane-3,20-dione + NADPH + H+ | Tetrahydrocorticosterone:NADP+ oxidoreductase (B-specific) |
R04840 | Tetrahydrocorticosterone + NADP+ <=> 3alpha,21-Dihydroxy-5beta-pregnane-11,20-dione + NADPH + H+ | Tetrahydrocorticosterone:NADP+ 11-oxidoreductase |
Table of KEGG human pathways containing Tetrahydrocorticosterone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |