RefMet Compound Details
RefMet ID | RM0159438 | |
---|---|---|
MW structure | 67409 (View MW Metabolite Database details) | |
RefMet name | Thiamine diphosphate | |
Systematic name | 2-[3-[(4-amino-2-methyl-pyrimidin-5-yl)methyl]-4-methyl-thiazol-3-ium-5-yl]ethyl phosphono hydrogen phosphate | |
SMILES | Cc1c(CCOP(=O)(O)OP(=O)(O)O)sc[n+]1Cc1cnc(C)nc1N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 425.044974 (neutral) |
Table of KEGG reactions in human pathways involving Thiamine diphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00615 | Thiamin diphosphate + H2O <=> Thiamin monophosphate + Orthophosphate | Thiamin diphosphate phosphohydrolase |
R00616 | ATP + Thiamin diphosphate <=> ADP + Thiamin triphosphate | ATP:thiamine-diphosphate phosphotransferase |
R00617 | ATP + Thiamin monophosphate <=> ADP + Thiamin diphosphate | ATP:thiamin-phosphate phosphotransferase |
R00618 | Thiamin triphosphate + H2O <=> Thiamin diphosphate + Orthophosphate | Thiamin-triphosphate phosphohydrolase |
R00619 | ATP + Thiamine <=> AMP + Thiamin diphosphate | ATP:thiamine diphosphotransferase |
R11319 | Thiamin diphosphate + ADP <=> Thiamin triphosphate + AMP | ADP:thiamin-diphosphate phosphotransferase |
Table of KEGG human pathways containing Thiamine diphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00280 | Valine, leucine and isoleucine degradation | 6 |
hsa00020 | Citrate cycle (TCA cycle) | 4 |
hsa00730 | Thiamine metabolism | 4 |
hsa00010 | Glycolysis / Gluconeogenesis | 2 |
hsa00620 | Pyruvate metabolism | 2 |
hsa01100 | Metabolic pathways | 2 |