RefMet Compound Details

Created with Raphaƫl 2.1.0OOHNH2OH
RefMet ID, RefMet name, exact mass and formula
RefMet IDRM0135896
RefMet nameTyrosine
Systematic name(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid
SynonymsPubChem Synonyms
Exact mass181.073894 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC9H11NO3View other entries in RefMet with this formula
Molecular descriptors
Molfile37107 (Download molfile/View MW Metabolite Database details)
InChIInChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1
InChIKeyOUYCCCASQSFEME-QMMMGPOBSA-NView other enantiomers/diastereomers of this metabolite in RefMet
SMILESc1cc(ccc1C[C@@H](C(=O)O)N)O
Run Tanimoto similarity search (with similarity coefficient >=0.6)
Chemical/Biochemical Classification
Super ClassOrganic acids
Main ClassAmino acids and peptides
Sub ClassAmino acids
Distribution of Tyrosine in NMDR studies
SpeciesPlot Species distribution
Sample sourcePlot Sample source(tissue) distribution
PlatformPlatform (MS/NMR) used for detection
ChromatographyChromatography methods used for detection
StudiesNMDR Studies reporting Tyrosine
External Links
Pubchem CID6057
ChEBI ID17895
KEGG IDC00082
HMDB IDHMDB0000158
Chemspider ID5833
MetaCyc IDTYR
EPA CompToxDTXCID00199786
Spectral data for Tyrosine standards
BMRB ID(NMR)View NMR spectra
NP-MRD ID(NMR)View NMR spectra
MassBank(EU)View MS spectra
Structural annotation level
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving Tyrosine

Rxn IDKEGG ReactionEnzyme
R00031 Oxygen + 2 L-Tyrosine <=> 2 3,4-Dihydroxy-L-phenylalanine1,2-benzenediol:oxygen oxidoreductase
R00729 L-Tyrosine + H2O + Oxygen <=> 3-(4-Hydroxyphenyl)pyruvate + Ammonia + Hydrogen peroxideL-Tyrosine:oxygen oxidoreductase (deaminating)
R00731 L-Tyrosine + Oxygen <=> 3,4-Dihydroxy-L-phenylalanine + H2OL-Tyrosine:oxygen oxidoreductase
R00734 L-Tyrosine + 2-Oxoglutarate <=> 3-(4-Hydroxyphenyl)pyruvate + L-GlutamateL-tyrosine:2-oxoglutarate aminotransferase
R00736 L-Tyrosine <=> Tyramine + CO2L-tyrosine carboxy-lyase (tyramine-forming)
R01795 Tetrahydrobiopterin + L-Phenylalanine + Oxygen <=> Dihydrobiopterin + L-Tyrosine + H2OL-Phenylalanine,tetrahydrobiopterin:oxygen oxidoreductase (4-hydroxylating)
R01815 Tetrahydrobiopterin + L-Tyrosine + Oxygen <=> 3,4-Dihydroxy-L-phenylalanine + Dihydrobiopterin + H2OL-Tyrosine,tetrahydrobiopterin:oxygen oxidoreductase (3-hydroxylating)
R02078 3,4-Dihydroxy-L-phenylalanine + L-Tyrosine + Oxygen <=> Dopaquinone + 3,4-Dihydroxy-L-phenylalanine + H2OL-Tyrosine,L-dopa:oxygen oxidoreductase
R02918 ATP + L-Tyrosine + tRNA(Tyr) <=> AMP + Diphosphate + L-Tyrosyl-tRNA(Tyr)L-Tyrosine:tRNA(Tyr) ligase (AMP-forming)
R03539 Hydroiodic acid + 3-Iodo-L-tyrosine <=> Iodine + L-TyrosineHydroiodic acid + 3-Iodo-L-tyrosine <=> Iodine + L-Tyrosine
R09254 L-Tyrosine + Pyruvate <=> 3-(4-Hydroxyphenyl)pyruvate + L-AlanineL-tyrosine:pyruvate aminotransferase
R09830 L-Tyrosine + H2O + NAD+ <=> 3-(4-Hydroxyphenyl)pyruvate + Ammonia + NADH + H+L-Tyrosine:NAD+ oxidoreductase (deaminating)
R12611 L-Tyrosine + Hydrogen peroxide <=> 3,4-Dihydroxy-L-phenylalanine + H2OL-tyrosine:hydrogen-peroxide oxidoreductase (L-dopa-forming)

Table of KEGG human pathways containing Tyrosine

Pathway IDHuman Pathway# of reactions
hsa00350 Tyrosine metabolism 7
hsa01100 Metabolic pathways 4
hsa00400 Phenylalanine, tyrosine and tryptophan biosynthesis 3
hsa01230 Biosynthesis of amino acids 2
hsa00130 Ubiquinone and other terpenoid-quinone biosynthesis 1
hsa00970 Aminoacyl-tRNA biosynthesis 1
hsa00360 Phenylalanine metabolism 1
  logo