RefMet Compound Details
MW structure | 37553 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | UDP-D-Xylose | |
Systematic name | {[(2R,3S,4R)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}({[hydroxy({[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy})phosphoryl]oxy})phosphinic acid | |
SMILES | c1cn([C@H]2[C@@H]([C@@H]([C@@H](COP(=O)(O)OP(=O)(O)OC3[C@@H]([C@H]([C@@H](CO3)O)O)O)O2)O)O)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 536.044464 (neutral) |
Table of KEGG reactions in human pathways involving UDP-D-Xylose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01384 | UDP-glucuronate <=> UDP-D-xylose + CO2 | UDP-D-glucuronate carboxy-lyase (UDP-D-xylose-forming) |
Table of KEGG human pathways containing UDP-D-Xylose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00520 | Amino sugar and nucleotide sugar metabolism | 1 |