RefMet Compound Details
RefMet ID | RM0160954 | |
---|---|---|
MW structure | 50580 (View MW Metabolite Database details) | |
RefMet name | UDP-N-acetylgalactosamine | |
Systematic name | uridine 5'-[3-(2-acetamido-2-deoxy-D-galactopyranosyl) dihydrogen diphosphate] | |
SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@@H](CO)OC1OP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2ccc(=O)[nH]c2=O)O1)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 607.081578 (neutral) |
Table of KEGG reactions in human pathways involving UDP-N-acetylgalactosamine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00418 | UDP-N-acetyl-alpha-D-glucosamine <=> UDP-N-acetyl-D-galactosamine | UDP-N-acetyl-D-glucosamine 4-epimerase |
R10183 | UTP + N-Acetyl-alpha-D-galactosamine 1-phosphate <=> Diphosphate + UDP-N-acetyl-D-galactosamine | UTP:N-acetyl-alpha-D-galactosamine-1-phosphate uridylyltransferase |
Table of KEGG human pathways containing UDP-N-acetylgalactosamine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01250 | Biosynthesis of nucleotide sugars | 2 |
hsa00520 | Amino sugar and nucleotide sugar metabolism | 1 |
hsa01100 | Metabolic pathways | 1 |