RefMet Compound Details
RefMet ID | RM0135928 | |
---|---|---|
MW structure | 37181 (View MW Metabolite Database details) | |
RefMet name | UDP-glucose | |
Systematic name | [({[(2S,3R,4S,5S)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]({[(3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy})phosphinic acid | |
SMILES | c1cn([C@@H]2[C@H]([C@H]([C@H](COP(=O)(O)OP(=O)(O)OC3[C@H]([C@@H]([C@H]([C@H](CO)O3)O)O)O)O2)O)O)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 566.055029 (neutral) |
Table of KEGG reactions in human pathways involving UDP-glucose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00286 | UDP-glucose + H2O + 2 NAD+ <=> UDP-glucuronate + 2 NADH + 2 H+ | UDP-glucose:NAD+ 6-oxidoreductase |
R00287 | UDP-glucose + H2O <=> UMP + D-Glucose 1-phosphate | UDP-glucose glucophosphohydrolase |
R00289 | UTP + D-Glucose 1-phosphate <=> Diphosphate + UDP-glucose | UTP:alpha-D-glucose-1-phosphate uridylyltransferase |
R00291 | UDP-glucose <=> UDP-alpha-D-galactose | UDP-glucose 4-epimerase |
R00292 | UDP-glucose + Amylose <=> UDP + Amylose | UDP-glucose:glycogen 4-alpha-D-glucosyltransferase |
R00955 | UDP-glucose + alpha-D-Galactose 1-phosphate <=> D-Glucose 1-phosphate + UDP-alpha-D-galactose | UDP-glucose:alpha-D-galactose-1-phosphate uridylyltransferase |
Table of KEGG human pathways containing UDP-glucose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00520 | Amino sugar and nucleotide sugar metabolism | 4 |
hsa00052 | Galactose metabolism | 3 |
hsa00500 | Starch and sucrose metabolism | 3 |
hsa00040 | Pentose and glucuronate interconversions | 2 |
hsa00053 | Ascorbate and aldarate metabolism | 1 |