RefMet Compound Details
MW structure | 37183 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Uric acid | |
Systematic name | 2,3,6,7,8,9-hexahydro-1H-purine-2,6,8-trione | |
SMILES | c12c([nH]c(=O)[nH]2)[nH]c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 168.028341 (neutral) |
Table of KEGG reactions in human pathways involving Uric acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02103 | Xanthine + NAD+ + H2O <=> Urate + NADH + H+ | xanthine:NAD+ oxidoreductase |
R02107 | Xanthine + H2O + Oxygen <=> Urate + Hydrogen peroxide | Xanthine:oxygen oxidoreductase |
Table of KEGG human pathways containing Uric acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 2 |