RefMet Compound Details
| RefMet ID, RefMet name, exact mass and formula | ||
| RefMet ID | RM0157981 | |
|---|---|---|
| RefMet name | Vicianose | |
| Systematic name | alpha-L-arabinopyranosyl-(1->-6)-beta-D-glucopyranose | |
| Synonyms | PubChem Synonyms | |
| Exact mass | 312.105647 (neutral) | Calculate m/z:
View other RefMet entries with this exact (neutral) mass: +/- 0.05 amu +/- 0.1 amu +/- 0.2 amu +/- 0.5 amu |
| Formula | C11H20O10 | View other entries in RefMet with this formula |
| Molecular descriptors | ||
| Molfile | 50408 (Download molfile/View MW Metabolite Database details) | |
| InChI | InChI=1S/C11H20O10/c12-3-1-19-11(9(17)5(3)13)20-2-4-6(14)7(15)8(16)10(18)21-4/h3-18H,1-2H2/t3-,4+,5-,6+,7-,8+,9+,10?,11-/m0/s1 | |
| InChIKey | QYNRIDLOTGRNML-ULAALWPKSA-N | View other enantiomers/diastereomers of this metabolite in RefMet |
| SMILES | C1[C@@H]([C@@H]([C@H]([C@@H](O1)OC[C@@H]1[C@H]([C@@H]([C@H](C(O)O1)O)O)O)O)O)O
Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
| Chemical/Biochemical Classification | ||
| Super Class | Organic oxygen compounds | |
| Main Class | Organooxygen compounds | |
| Sub Class | Organooxygen compounds | |
| Distribution of Vicianose in NMDR studies | ||
| Species | Plot Species distribution | |
| Sample source | Plot Sample source(tissue) distribution | |
| Platform | Platform (MS/NMR) used for detection | |
| Chromatography | Chromatography methods used for detection | |
| Studies | NMDR Studies reporting Vicianose | |
| External Links | ||
| Pubchem CID | 439537 | |
| ChEBI ID | 16177 | |
| KEGG ID | C01625 | |
| HMDB ID | HMDB0029897 | |
| MetaCyc ID | VICIANOSE | |
| EPA CompTox | DTXCID60964033 | |
| Structural annotation level | ||
| Annotation level | 1 (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition) | |
