RefMet Compound Details
MW structure | 38361 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Vitamin K1 | |
Systematic name | 2-methyl-3-[(2E)-3,7,11,15-tetramethylhexadec-2-en-1-yl]-1,4-dihydronaphthalene-1,4-dione | |
SMILES | CC(C)CCCC(C)CCCC(C)CCC/C(=C/CC1=C(C)C(=O)c2ccccc2C1=O)/C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 450.349780 (neutral) |
Table of KEGG reactions in human pathways involving Vitamin K1
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03511 | Phylloquinone + Oxidized dithiothreitol + H2O <=> Vitamin K1 epoxide + Dithiothreitol | phylloquinone:oxidized-dithiothreitol oxidoreductase |
R03816 | Phylloquinone + NADH + H+ <=> Phylloquinol + NAD+ | NADH:phylloquinone oxidoreductase |
Table of KEGG human pathways containing Vitamin K1
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00130 | Ubiquinone and other terpenoid-quinone biosynthesis | 2 |