RefMet Compound Details
MW structure | 29108 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Vitamin K2 | |
Systematic name | 2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl]-3-methylnaphthalene-1,4-dione | |
SMILES | CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC/C(=C/CC1=C(C)C(=O)c2ccccc2C1=O)/C)/C)/C)/C)/C)C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 580.428030 (neutral) |
Table of KEGG reactions in human pathways involving Vitamin K2
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02964 | Menaquinone + H+ + NADH <=> Menaquinol + NAD+ | NADH:menaquinone oxidoreductase |
R09992 | 2,3-Epoxymenaquinone + Dithiothreitol <=> Menaquinone + Oxidized dithiothreitol + H2O | menaquinone:oxidized-dithiothreitol oxidoreductase |
Table of KEGG human pathways containing Vitamin K2
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00130 | Ubiquinone and other terpenoid-quinone biosynthesis | 2 |