RefMet Compound Details
RefMet ID | RM0136029 | |
---|---|---|
MW structure | 37475 (View MW Metabolite Database details) | |
RefMet name | Xylulose 5-phosphate | |
Systematic name | {[(2R,3S)-2,3,5-trihydroxy-4-oxopentyl]oxy}phosphonic acid | |
SMILES | C(C(=O)[C@H]([C@@H](COP(=O)(O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 230.019158 (neutral) |
Table of KEGG reactions in human pathways involving Xylulose 5-phosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01529 | D-Ribulose 5-phosphate <=> D-Xylulose 5-phosphate | D-Ribulose-5-phosphate 3-epimerase |
R01639 | ATP + D-Xylulose <=> ADP + D-Xylulose 5-phosphate | ATP:D-xylulose 5-phosphotransferase |
Table of KEGG human pathways containing Xylulose 5-phosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00030 | Pentose phosphate pathway | 3 |
hsa01200 | Carbon metabolism | 3 |
hsa01230 | Biosynthesis of amino acids | 3 |
hsa00040 | Pentose and glucuronate interconversions | 2 |