RefMet Compound Details
MW structure | 34402 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Zymostenol | |
Systematic name | 5alpha-cholest-8-en-3beta-ol | |
SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3=C(CC[C@]12C)[C@@]1(C)CC[C@@H](C[C@@H]1CC3)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 27:1;O | View other entries in RefMet with this sum composition |
Exact mass | 386.354865 (neutral) |
Table of KEGG reactions in human pathways involving Zymostenol
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03353 | Lathosterol <=> 5alpha-Cholest-8-en-3beta-ol | 5alpha-Cholest-7-en-3beta-ol delta7-delta8-isomerase |
R07498 | Zymosterol + NADPH + H+ <=> 5alpha-Cholest-8-en-3beta-ol + NADP+ | Zymosterol + NADPH + H+ <=> 5alpha-Cholest-8-en-3beta-ol + NADP+ |
Table of KEGG human pathways containing Zymostenol
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00100 | Steroid biosynthesis | 2 |