RefMet Compound Details

RefMet IDRM0018361
MW structure35273 (View MW Metabolite Database details)
RefMet namebeta-Estradiol
Systematic nameestra-1,3,5(10)-triene-3,17beta-diol
SMILESC[C@]12CC[C@@H]3c4ccc(cc4CC[C@H]3[C@@H]1CC[C@@H]2O)O   Run Tanimoto similarity search (with similarity coefficient >=0.6)
Sum CompositionST 18:3;O2 View other entries in RefMet with this sum composition
Exact mass272.177630 (neutral)
Calculate m/z:   
View other RefMet entries with this exact (neutral) mass:   +/- 0.05 amu   +/- 0.1 amu   +/- 0.2 amu   +/- 0.5 amu
FormulaC18H24O2View other entries in RefMet with this formula
InChIInChI=1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,
17+,18+/m1/s1
InChIKeyVOXZDWNPVJITMN-ZBRFXRBCSA-NView other enantiomers/diastereomers of this metabolite in RefMet
Super ClassSterol Lipids
Main ClassSteroids
Sub ClassC18 Steroids
Pubchem CID5757
ChEBI ID16469
Annotation level1   (1:Known structure; 2:Known regiochemistry; 3:Partial structure; 4:Sum-composition)

Table of KEGG reactions in human pathways involving beta-Estradiol

Rxn IDKEGG ReactionEnzyme
R02352 Estradiol-17beta + NAD+ <=> Estrone + NADH + H+Estradiol-17beta:NAD+ 17-oxidoreductase
R02353 Estradiol-17beta + NADP+ <=> Estrone + NADPH + H+Estradiol-17beta:NADP+ 17-oxidoreductase
R03087 19-Oxotestosterone + Oxygen + [Reduced NADPH---hemoprotein reductase] <=> Estradiol-17beta + Formate + [Oxidized NADPH---hemoprotein reductase] + H2O19-oxotestosterone,NADPH---hemoprotein reductase:oxygen oxidoreductase (aromatizing, formate-forming)
R03088 Estradiol-17beta + H+ + Oxygen + NADH <=> 2-Hydroxyestradiol + NAD+ + H2OEstradiol-17beta + H+ + Oxygen + NADH <=> 2-Hydroxyestradiol + NAD+ + H2O
R03089 Estradiol-17beta + H+ + Oxygen + NADPH <=> Estriol + NADP+ + H2OEstradiol-17beta + H+ + Oxygen + NADPH <=> Estriol + NADP+ + H2O
R03090 Estradiol-17beta + H+ + Oxygen + NADPH <=> 2-Hydroxyestradiol + NADP+ + H2OEstradiol-17beta + H+ + Oxygen + NADPH <=> 2-Hydroxyestradiol + NADP+ + H2O
R03091 Estradiol-17beta + UDP-glucuronate <=> Estradiol-17beta 3-glucuronide + UDPUDPglucuronate beta-D-glucuronosyltransferase(acceptor-unspecific)

Table of KEGG human pathways containing beta-Estradiol

Pathway IDHuman Pathway# of reactions
hsa00140 Steroid hormone biosynthesis 7
hsa01100 Metabolic pathways 2
  logo