RefMet Compound Details
MW structure | 16373 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | beta-Hydroarchaetidylethanolamine | |
Systematic name | 1-(3-hydroxyphytanyl)-2-phytanyl-sn-glycero-3-phosphoethanolamine | |
SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@@H](C)CCOC[C@H](COP(=O)(O)OCCN)OCCC(C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 791.676793 (neutral) |
Table of KEGG reactions in human pathways involving beta-Hydroarchaetidylethanolamine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04571 | 1-Alkyl-2-acylglycerophosphoethanolamine + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> O-1-Alk-1-enyl-2-acyl-sn-glycero-3-phosphoethanolamine + 2 Ferricytochrome b5 + 2 H2O | plasmanylethanolamine,ferrocytochrome b5:oxygen oxidoreductase (plasmenylethanolamine-forming) |
R06364 | CDP-ethanolamine + 1-Alkyl-2-acylglycerol <=> CMP + 1-Alkyl-2-acylglycerophosphoethanolamine | CDPethanolamine:1-alkyl-2-acylglycerol ethanolaminephosphotransferase |
Table of KEGG human pathways containing beta-Hydroarchaetidylethanolamine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00565 | Ether lipid metabolism | 2 |
hsa01100 | Metabolic pathways | 1 |