RefMet Compound Details
MW structure | 38934 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | dIMP | |
Systematic name | {[(2R,3S,5R)-3-hydroxy-5-(6-oxo-6,9-dihydro-3H-purin-9-yl)oxolan-2-yl]methoxy}phosphonic acid | |
SMILES | C1[C@@H]([C@@H](COP(=O)(O)O)O[C@H]1n1cnc2c1nc[nH]c2=O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 332.052189 (neutral) |
Table of KEGG reactions in human pathways involving dIMP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R10235 | dIDP + H2O <=> 2'-Deoxyinosine 5'-phosphate + Orthophosphate | deoxyinosine diphosphate phosphatase |
R03531 | dITP + H2O <=> 2'-Deoxyinosine 5'-phosphate + Diphosphate | 2'-Deoxyinosine-5'-triphosphate pyrophosphohydrolase |
R12958 | 2'-Deoxyinosine 5'-phosphate + H2O <=> Deoxyinosine + Orthophosphate | dIMP phosphohydrolase |
Table of KEGG human pathways containing dIMP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 2 |
hsa01232 | Nucleotide metabolism | 1 |