RefMet Compound Details
MW structure | 573 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | gamma-Linolenic acid | |
Alternative name | FA 18:3(6Z,9Z,12Z) | |
Systematic name | 6Z,9Z,12Z-octadecatrienoic acid | |
SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(O)=O | |
Exact mass | 278.224580 (neutral) |
Table of KEGG reactions in human pathways involving gamma-Linolenic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08181 | gamma-Linolenoyl-CoA + H2O <=> CoA + (6Z,9Z,12Z)-Octadecatrienoic acid | gamma-Linolenoyl-CoA + H2O <=> CoA + (6Z,9Z,12Z)-Octadecatrienoic acid |
Table of KEGG human pathways containing gamma-Linolenic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01040 | Biosynthesis of unsaturated fatty acids | 1 |