RefMet Compound Details
RefMet ID | RM0153984 | |
---|---|---|
MW structure | 50123 (View MW Metabolite Database details) | |
RefMet name | gamma-Linolenoyl-CoA | |
Alternative name | CoA 18:3 | |
Systematic name | 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-({3-[(2-{[(6Z,12Z,15Z)-octadeca-6,12,15-trienoyl]sulfanyl}ethyl)amino]-3-oxopropyl}amino)-4-oxobutyl] dihydrogen diphosphate} | |
SMILES | CCCCC/C=CC/C=CC/C=CCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 18:3 | View other entries in RefMet with this sum composition |
Exact mass | 1027.329234 (neutral) |
Table of KEGG reactions in human pathways involving gamma-Linolenoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03814 | Linoleoyl-CoA + 2 Ferrocytochrome b5 + Oxygen + 2 H+ <=> gamma-Linolenoyl-CoA + 2 Ferricytochrome b5 + 2 H2O | linoleoyl-CoA,ferrocytochrome b5:oxygen oxidoreductase (6,7 cis-dehydrogenating) |
R08181 | gamma-Linolenoyl-CoA + H2O <=> CoA + (6Z,9Z,12Z)-Octadecatrienoic acid | gamma-Linolenoyl-CoA + H2O <=> CoA + (6Z,9Z,12Z)-Octadecatrienoic acid |
Table of KEGG human pathways containing gamma-Linolenoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01040 | Biosynthesis of unsaturated fatty acids | 2 |
hsa01212 | Fatty acid metabolism | 1 |