RefMet Compound Details
MW structure | 37079 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | sn-Glycero-3-phosphoethanolamine | |
Systematic name | sn-Glycero-3-phosphoethanolamine | |
SMILES | C(COP(=O)(O)OC[C@@H](CO)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 215.055877 (neutral) |
Table of KEGG reactions in human pathways involving sn-Glycero-3-phosphoethanolamine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R03416 | 1-Acyl-sn-glycero-3-phosphoethanolamine + H2O <=> Fatty acid + sn-Glycero-3-phosphoethanolamine | 1-Acyl-sn-glycero-3-phosphoethanolamine aldehydohydrolase |
R01470 | sn-Glycero-3-phosphoethanolamine + H2O <=> Ethanolamine + sn-Glycerol 3-phosphate | sn-Glycero-3-phosphoethanolamine glycerophosphohydrolase |
R03415 | 1-(1-Alkenyl)-sn-glycero-3-phosphoethanolamine + H2O <=> Aldehyde + sn-Glycero-3-phosphoethanolamine | 1-(1-alkenyl)-sn-glycero-3-phosphoethanolamine aldehydohydrolase |
R03417 | 2-Acyl-sn-glycero-3-phosphoethanolamine + H2O <=> Fatty acid + sn-Glycero-3-phosphoethanolamine | L-2-Lysophosphatidylethanolamine aldehydohydrolase |
Table of KEGG human pathways containing sn-Glycero-3-phosphoethanolamine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00564 | Glycerophospholipid metabolism | 3 |
hsa00565 | Ether lipid metabolism | 1 |