RefMet Compound Details
RefMet ID | RM0153972 | |
---|---|---|
MW structure | 41135 (View MW Metabolite Database details) | |
RefMet name | trans,cis-Lauro-2,6-dienoyl-CoA | |
Alternative name | CoA 12:2(2E,6Z) | |
Systematic name | {[(2R,3R,5R)-5-(6-amino-9H-purin-9-yl)-2-({[({[(3R)-3-{[2-({2-[(2E,5Z)-dodeca-2,5-dienoylsulfanyl]ethyl}carbamoyl)ethyl]carbamoyl}-3-hydroxy-2,2-dimethylpropoxy](hydroxy)phosphoryl}oxy)(hydroxy)phosphoryl]oxy}methyl)-4-hydroxyoxolan-3-yl]oxy}phosphonic acid | |
SMILES | CCCCCC/C=CC/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)OP(=O)(O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 12:2 | View other entries in RefMet with this sum composition |
Exact mass | 945.250984 (neutral) |
Table of KEGG reactions in human pathways involving trans,cis-Lauro-2,6-dienoyl-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04756 | cis,cis-3,6-Dodecadienoyl-CoA <=> trans,cis-Lauro-2,6-dienoyl-CoA | cis,cis-3,6-Dodecadienoyl-CoA delta3-cis-delta2-trans-isomerase |
Table of KEGG human pathways containing trans,cis-Lauro-2,6-dienoyl-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00071 | Fatty acid degradation | 1 |