RefMet Compound Details
RefMet ID | RM0136354 | |
---|---|---|
MW structure | 41133 (View MW Metabolite Database details) | |
RefMet name | trans-2-Enoyl-OPC6-CoA | |
SMILES | CC/C=CC[C@H]1[C@@H](CCC/C=C/C(=O)SCCNC(=O)CCNC(=O)[C@@H](C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]2[C@H]([C@H]([C@H](n3cnc4c(N)ncnc34)O2)O)OP(=O)(O)O)O)CCC1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | CoA 16:4;O | View other entries in RefMet with this sum composition |
Exact mass | 1013.277188 (neutral) |
Table of KEGG reactions in human pathways involving trans-2-Enoyl-OPC6-CoA
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07892 | OPC6-CoA + FAD <=> trans-2-Enoyl-OPC6-CoA + FADH2 | OPC6-CoA + FAD <=> trans-2-Enoyl-OPC6-CoA + FADH2 |
Table of KEGG human pathways containing trans-2-Enoyl-OPC6-CoA
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00592 | alpha-Linolenic acid metabolism | 1 |