RefMet Compound Details
RefMet ID | RM0133188 | |
---|---|---|
MW structure | 37583 (View MW Metabolite Database details) | |
RefMet name | S-Lactoylglutathione | |
Systematic name | (2S)-2-amino-4-{[(1R)-1-[(carboxymethyl)carbamoyl]-2-{[(2R)-2-hydroxypropanoyl]sulfanyl}ethyl]carbamoyl}butanoic acid | |
SMILES | C[C@H](C(=O)SC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 379.104939 (neutral) |
Table of KEGG reactions in human pathways involving S-Lactoylglutathione
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01736 | (R)-S-Lactoylglutathione + H2O <=> Glutathione + (R)-Lactate | (R)-S-Lactoylglutathione hydrolase |
R02530 | (R)-S-Lactoylglutathione <=> Glutathione + Methylglyoxal | (R)-S-Lactoylglutathione methylglyoxal-lyase (isomerizing) |
Table of KEGG human pathways containing S-Lactoylglutathione
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00620 | Pyruvate metabolism | 2 |